C27H29N3O5 — CID 73259862
1'-[3-(dimethylamino)propyl]-4'-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-methylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione (PubChem CID 73259862) has the molecular formula C27H29N3O5 and a molecular weight of 475.55 g/mol. Its IUPAC name is 1'-[3-(dimethylamino)propyl]-4'-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-methylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione.
| Compound Name | 1'-[3-(dimethylamino)propyl]-4'-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-methylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione |
|---|---|
| PubChem CID | 73259862 |
| Molecular Formula | C27H29N3O5 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 1'-[3-(dimethylamino)propyl]-4'-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-methylspiro[indole-3,5'-pyrrolidine]-2,2',3'-trione |
| SMILES | CC1Cc2cc(C(O)=C3C(=O)C(=O)N(CCCN(C)C)C34C(=O)N(C)c3ccccc34)ccc2O1 |
| InChI | InChI=1S/C27H29N3O5/c1-16-14-18-15-17(10-11-21(18)35-16)23(31)22-24(32)25(33)30(13-7-12-28(2)3)27(22)19-8-5-6-9-20(19)29(4)26(27)34/h5-6,8-11,15-16,31H,7,12-14H2,1-4H3 |
| InChIKey | LRPULMYBIMKRCY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|