C32H32N4O6S — CID 18818899
(4'Z)-1-butyl-4'-[hydroxy-(4-pyrrolidin-1-ylsulfonylphenyl)methylidene]-1'-(pyridin-3-ylmethyl)spiro[indole-3,5'-pyrrolidine]-2,2',3'-trione (PubChem CID 18818899) has the molecular formula C32H32N4O6S and a molecular weight of 600.70 g/mol. Its IUPAC name is (4'Z)-1-butyl-4'-[hydroxy-(4-pyrrolidin-1-ylsulfonylphenyl)methylidene]-1'-(pyridin-3-ylmethyl)spiro[indole-3,5'-pyrrolidine]-2,2',3'-trione.
| Compound Name | (4'Z)-1-butyl-4'-[hydroxy-(4-pyrrolidin-1-ylsulfonylphenyl)methylidene]-1'-(pyridin-3-ylmethyl)spiro[indole-3,5'-pyrrolidine]-2,2',3'-trione |
|---|---|
| PubChem CID | 18818899 |
| Molecular Formula | C32H32N4O6S |
| Molecular Weight | 600.70 g/mol |
| Exact Mass | 600.20 |
| IUPAC Name | (4'Z)-1-butyl-4'-[hydroxy-(4-pyrrolidin-1-ylsulfonylphenyl)methylidene]-1'-(pyridin-3-ylmethyl)spiro[indole-3,5'-pyrrolidine]-2,2',3'-trione |
| SMILES | CCCCN1C(=O)C2(/C(=C(/O)c3ccc(S(=O)(=O)N4CCCC4)cc3)C(=O)C(=O)N2Cc2cccnc2)c2ccccc21 |
| InChI | InChI=1S/C32H32N4O6S/c1-2-3-19-35-26-11-5-4-10-25(26)32(31(35)40)27(29(38)30(39)36(32)21-22-9-8-16-33-20-22)28(37)23-12-14-24(15-13-23)43(41,42)34-17-6-7-18-34/h4-5,8-16,20,37H,2-3,6-7,17-19,21H2,1H3/b28-27+ |
| InChIKey | AFEKECHMVQXCKD-BYYHNAKLSA-N |
| XLogP | 3.79 |
| TPSA | 128.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.70 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|