C29H26N4O6S — CID 18818789
4-[(Z)-hydroxy-[2,4',5'-trioxo-1-prop-2-enyl-1'-(pyridin-3-ylmethyl)spiro[indole-3,2'-pyrrolidine]-3'-ylidene]methyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 18818789) has the molecular formula C29H26N4O6S and a molecular weight of 558.62 g/mol. Its IUPAC name is 4-[(Z)-hydroxy-[2,4',5'-trioxo-1-prop-2-enyl-1'-(pyridin-3-ylmethyl)spiro[indole-3,2'-pyrrolidine]-3'-ylidene]methyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[(Z)-hydroxy-[2,4',5'-trioxo-1-prop-2-enyl-1'-(pyridin-3-ylmethyl)spiro[indole-3,2'-pyrrolidine]-3'-ylidene]methyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 18818789 |
| Molecular Formula | C29H26N4O6S |
| Molecular Weight | 558.62 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | 4-[(Z)-hydroxy-[2,4',5'-trioxo-1-prop-2-enyl-1'-(pyridin-3-ylmethyl)spiro[indole-3,2'-pyrrolidine]-3'-ylidene]methyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | C=CCN1C(=O)C2(/C(=C(/O)c3ccc(S(=O)(=O)N(C)C)cc3)C(=O)C(=O)N2Cc2cccnc2)c2ccccc21 |
| InChI | InChI=1S/C29H26N4O6S/c1-4-16-32-23-10-6-5-9-22(23)29(28(32)37)24(26(35)27(36)33(29)18-19-8-7-15-30-17-19)25(34)20-11-13-21(14-12-20)40(38,39)31(2)3/h4-15,17,34H,1,16,18H2,2-3H3/b25-24+ |
| InChIKey | WTYANCGZZGOOQB-OCOZRVBESA-N |
| XLogP | 2.64 |
| TPSA | 128.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.62 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|