C29H25N3O6 — CID 5170469
4'-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-propyl-1'-(pyridin-3-ylmethyl)spiro[indole-3,5'-pyrrolidine]-2,2',3'-trione (PubChem CID 5170469) has the molecular formula C29H25N3O6 and a molecular weight of 511.53 g/mol. Its IUPAC name is 4'-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-propyl-1'-(pyridin-3-ylmethyl)spiro[indole-3,5'-pyrrolidine]-2,2',3'-trione.
| Compound Name | 4'-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-propyl-1'-(pyridin-3-ylmethyl)spiro[indole-3,5'-pyrrolidine]-2,2',3'-trione |
|---|---|
| PubChem CID | 5170469 |
| Molecular Formula | C29H25N3O6 |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | 4'-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-propyl-1'-(pyridin-3-ylmethyl)spiro[indole-3,5'-pyrrolidine]-2,2',3'-trione |
| SMILES | CCCN1C(=O)C2(C(=C(O)c3ccc4c(c3)OCCO4)C(=O)C(=O)N2Cc2cccnc2)c2ccccc21 |
| InChI | InChI=1S/C29H25N3O6/c1-2-12-31-21-8-4-3-7-20(21)29(28(31)36)24(25(33)19-9-10-22-23(15-19)38-14-13-37-22)26(34)27(35)32(29)17-18-6-5-11-30-16-18/h3-11,15-16,33H,2,12-14,17H2,1H3 |
| InChIKey | UXXCZVDEHFFNNH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 109.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|