C28H27N3O6S — CID 4623950
4-[hydroxy-(4-pyrrolidin-1-ylsulfonylphenyl)methylidene]-5-(4-methoxyphenyl)-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 4623950) has the molecular formula C28H27N3O6S and a molecular weight of 533.61 g/mol. Its IUPAC name is 4-[hydroxy-(4-pyrrolidin-1-ylsulfonylphenyl)methylidene]-5-(4-methoxyphenyl)-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[hydroxy-(4-pyrrolidin-1-ylsulfonylphenyl)methylidene]-5-(4-methoxyphenyl)-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4623950 |
| Molecular Formula | C28H27N3O6S |
| Molecular Weight | 533.61 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | 4-[hydroxy-(4-pyrrolidin-1-ylsulfonylphenyl)methylidene]-5-(4-methoxyphenyl)-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C2C(=C(O)c3ccc(S(=O)(=O)N4CCCC4)cc3)C(=O)C(=O)N2Cc2cccnc2)cc1 |
| InChI | InChI=1S/C28H27N3O6S/c1-37-22-10-6-20(7-11-22)25-24(27(33)28(34)31(25)18-19-5-4-14-29-17-19)26(32)21-8-12-23(13-9-21)38(35,36)30-15-2-3-16-30/h4-14,17,25,32H,2-3,15-16,18H2,1H3 |
| InChIKey | OKVZOHWAXMMWFM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 117.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.61 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|