C27H24FN3O5S — CID 6242855
(4E)-5-(4-fluorophenyl)-4-[hydroxy-(4-pyrrolidin-1-ylsulfonylphenyl)methylidene]-1-(pyridin-4-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 6242855) has the molecular formula C27H24FN3O5S and a molecular weight of 521.57 g/mol. Its IUPAC name is (4E)-5-(4-fluorophenyl)-4-[hydroxy-(4-pyrrolidin-1-ylsulfonylphenyl)methylidene]-1-(pyridin-4-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(4-fluorophenyl)-4-[hydroxy-(4-pyrrolidin-1-ylsulfonylphenyl)methylidene]-1-(pyridin-4-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6242855 |
| Molecular Formula | C27H24FN3O5S |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | (4E)-5-(4-fluorophenyl)-4-[hydroxy-(4-pyrrolidin-1-ylsulfonylphenyl)methylidene]-1-(pyridin-4-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(Cc2ccncc2)C(c2ccc(F)cc2)/C1=C(\O)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C27H24FN3O5S/c28-21-7-3-19(4-8-21)24-23(26(33)27(34)31(24)17-18-11-13-29-14-12-18)25(32)20-5-9-22(10-6-20)37(35,36)30-15-1-2-16-30/h3-14,24,32H,1-2,15-17H2/b25-23+ |
| InChIKey | CIMQTXOVMBNDOJ-WJTDDFOZSA-N |
| XLogP | 3.63 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|