C21H21N3O3S — CID 3431575
7-[(3,4-dimethoxyphenyl)methylidene]-3-(3-methylphenyl)-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one (PubChem CID 3431575) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is 7-[(3,4-dimethoxyphenyl)methylidene]-3-(3-methylphenyl)-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one.
| Compound Name | 7-[(3,4-dimethoxyphenyl)methylidene]-3-(3-methylphenyl)-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one |
|---|---|
| PubChem CID | 3431575 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 7-[(3,4-dimethoxyphenyl)methylidene]-3-(3-methylphenyl)-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one |
| SMILES | COc1ccc(C=c2sc3n(c2=O)CN(c2cccc(C)c2)CN=3)cc1OC |
| InChI | InChI=1S/C21H21N3O3S/c1-14-5-4-6-16(9-14)23-12-22-21-24(13-23)20(25)19(28-21)11-15-7-8-17(26-2)18(10-15)27-3/h4-11H,12-13H2,1-3H3 |
| InChIKey | BINZJLQMIXCNPM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 56.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |