C20H17N3O4S — CID 3146227
3-(1,3-benzodioxol-5-yl)-7-[(4-methoxyphenyl)methylidene]-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one (PubChem CID 3146227) has the molecular formula C20H17N3O4S and a molecular weight of 395.44 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-7-[(4-methoxyphenyl)methylidene]-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-7-[(4-methoxyphenyl)methylidene]-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one |
|---|---|
| PubChem CID | 3146227 |
| Molecular Formula | C20H17N3O4S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-7-[(4-methoxyphenyl)methylidene]-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one |
| SMILES | COc1ccc(C=c2sc3n(c2=O)CN(c2ccc4c(c2)OCO4)CN=3)cc1 |
| InChI | InChI=1S/C20H17N3O4S/c1-25-15-5-2-13(3-6-15)8-18-19(24)23-11-22(10-21-20(23)28-18)14-4-7-16-17(9-14)27-12-26-16/h2-9H,10-12H2,1H3 |
| InChIKey | ZKIJIJYNYUQKLE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 65.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|