C18H14IN3OS — CID 3528481
7-benzylidene-3-(4-iodophenyl)-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one (PubChem CID 3528481) has the molecular formula C18H14IN3OS and a molecular weight of 447.30 g/mol. Its IUPAC name is 7-benzylidene-3-(4-iodophenyl)-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one.
| Compound Name | 7-benzylidene-3-(4-iodophenyl)-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one |
|---|---|
| PubChem CID | 3528481 |
| Molecular Formula | C18H14IN3OS |
| Molecular Weight | 447.30 g/mol |
| Exact Mass | 446.99 |
| IUPAC Name | 7-benzylidene-3-(4-iodophenyl)-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one |
| SMILES | O=c1c(=Cc2ccccc2)sc2n1CN(c1ccc(I)cc1)CN=2 |
| InChI | InChI=1S/C18H14IN3OS/c19-14-6-8-15(9-7-14)21-11-20-18-22(12-21)17(23)16(24-18)10-13-4-2-1-3-5-13/h1-10H,11-12H2 |
| InChIKey | LUPAAHUKIOXGDR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|