C20H19N3O2S — CID 3353209
7-benzylidene-3-(4-ethoxyphenyl)-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one (PubChem CID 3353209) has the molecular formula C20H19N3O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is 7-benzylidene-3-(4-ethoxyphenyl)-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one.
| Compound Name | 7-benzylidene-3-(4-ethoxyphenyl)-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one |
|---|---|
| PubChem CID | 3353209 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 7-benzylidene-3-(4-ethoxyphenyl)-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one |
| SMILES | CCOc1ccc(N2CN=c3sc(=Cc4ccccc4)c(=O)n3C2)cc1 |
| InChI | InChI=1S/C20H19N3O2S/c1-2-25-17-10-8-16(9-11-17)22-13-21-20-23(14-22)19(24)18(26-20)12-15-6-4-3-5-7-15/h3-12H,2,13-14H2,1H3 |
| InChIKey | OQIJBRHOQVMEDE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 46.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|