C23H20N4OS — CID 34319696
(2S)-2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanyl-N-quinolin-5-ylpropanamide (PubChem CID 34319696) has the molecular formula C23H20N4OS and a molecular weight of 400.51 g/mol. Its IUPAC name is (2S)-2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanyl-N-quinolin-5-ylpropanamide.
| Compound Name | (2S)-2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanyl-N-quinolin-5-ylpropanamide |
|---|---|
| PubChem CID | 34319696 |
| Molecular Formula | C23H20N4OS |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | (2S)-2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanyl-N-quinolin-5-ylpropanamide |
| SMILES | Cc1cc(-c2ccccc2)nc(S[C@@H](C)C(=O)Nc2cccc3ncccc23)n1 |
| InChI | InChI=1S/C23H20N4OS/c1-15-14-21(17-8-4-3-5-9-17)27-23(25-15)29-16(2)22(28)26-20-12-6-11-19-18(20)10-7-13-24-19/h3-14,16H,1-2H3,(H,26,28)/t16-/m0/s1 |
| InChIKey | XGWCSCLFDFMHPX-INIZCTEOSA-N |
| XLogP | 5.12 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |