C16H17N3O3S — CID 8512446
methyl N-[(2S)-2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanylpropanoyl]carbamate (PubChem CID 8512446) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is methyl N-[(2S)-2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanylpropanoyl]carbamate.
| Compound Name | methyl N-[(2S)-2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanylpropanoyl]carbamate |
|---|---|
| PubChem CID | 8512446 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | methyl N-[(2S)-2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanylpropanoyl]carbamate |
| SMILES | COC(=O)NC(=O)[C@H](C)Sc1nc(C)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H17N3O3S/c1-10-9-13(12-7-5-4-6-8-12)18-15(17-10)23-11(2)14(20)19-16(21)22-3/h4-9,11H,1-3H3,(H,19,20,21)/t11-/m0/s1 |
| InChIKey | NIHOLDFFPCSEEI-NSHDSACASA-N |
| XLogP | 2.82 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |