C21H26N4O2S — CID 8731025
(2R)-N-(cyclohexylcarbamoyl)-2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanylpropanamide (PubChem CID 8731025) has the molecular formula C21H26N4O2S and a molecular weight of 398.53 g/mol. Its IUPAC name is (2R)-N-(cyclohexylcarbamoyl)-2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanylpropanamide.
| Compound Name | (2R)-N-(cyclohexylcarbamoyl)-2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 8731025 |
| Molecular Formula | C21H26N4O2S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | (2R)-N-(cyclohexylcarbamoyl)-2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanylpropanamide |
| SMILES | Cc1cc(-c2ccccc2)nc(S[C@H](C)C(=O)NC(=O)NC2CCCCC2)n1 |
| InChI | InChI=1S/C21H26N4O2S/c1-14-13-18(16-9-5-3-6-10-16)24-21(22-14)28-15(2)19(26)25-20(27)23-17-11-7-4-8-12-17/h3,5-6,9-10,13,15,17H,4,7-8,11-12H2,1-2H3,(H2,23,25,26,27)/t15-/m1/s1 |
| InChIKey | GIOOPKQNTYKJLA-OAHLLOKOSA-N |
| XLogP | 4.09 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |