C16H11Cl2N3O — CID 34329231
(E)-N-(benzimidazol-1-yl)-3-(3,4-dichlorophenyl)prop-2-enamide (PubChem CID 34329231) has the molecular formula C16H11Cl2N3O and a molecular weight of 332.19 g/mol. Its IUPAC name is (E)-N-(benzimidazol-1-yl)-3-(3,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(benzimidazol-1-yl)-3-(3,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 34329231 |
| Molecular Formula | C16H11Cl2N3O |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | (E)-N-(benzimidazol-1-yl)-3-(3,4-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)Nn1cnc2ccccc21 |
| InChI | InChI=1S/C16H11Cl2N3O/c17-12-7-5-11(9-13(12)18)6-8-16(22)20-21-10-19-14-3-1-2-4-15(14)21/h1-10H,(H,20,22)/b8-6+ |
| InChIKey | DPXWNPWAWKZIRP-SOFGYWHQSA-N |
| XLogP | 4.13 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|