C24H23N5O3 — CID 3434352
1-(2,4-dimethylphenyl)-2-[4-(4-nitrophenyl)piperazine-1-carbonyl]pyrrole-3-carbonitrile (PubChem CID 3434352) has the molecular formula C24H23N5O3 and a molecular weight of 429.48 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-2-[4-(4-nitrophenyl)piperazine-1-carbonyl]pyrrole-3-carbonitrile.
| Compound Name | 1-(2,4-dimethylphenyl)-2-[4-(4-nitrophenyl)piperazine-1-carbonyl]pyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 3434352 |
| Molecular Formula | C24H23N5O3 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-2-[4-(4-nitrophenyl)piperazine-1-carbonyl]pyrrole-3-carbonitrile |
| SMILES | Cc1ccc(-n2ccc(C#N)c2C(=O)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)c(C)c1 |
| InChI | InChI=1S/C24H23N5O3/c1-17-3-8-22(18(2)15-17)28-10-9-19(16-25)23(28)24(30)27-13-11-26(12-14-27)20-4-6-21(7-5-20)29(31)32/h3-10,15H,11-14H2,1-2H3 |
| InChIKey | IMIGNAJYZPTGLB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 95.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|