C24H24N4O3S — CID 26199722
[2-(2,4-dimethylphenyl)sulfanyl-3-pyridinyl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 26199722) has the molecular formula C24H24N4O3S and a molecular weight of 448.55 g/mol. Its IUPAC name is [2-(2,4-dimethylphenyl)sulfanyl-3-pyridinyl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | [2-(2,4-dimethylphenyl)sulfanyl-3-pyridinyl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 26199722 |
| Molecular Formula | C24H24N4O3S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | [2-(2,4-dimethylphenyl)sulfanyl-3-pyridinyl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | Cc1ccc(Sc2ncccc2C(=O)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)c(C)c1 |
| InChI | InChI=1S/C24H24N4O3S/c1-17-5-10-22(18(2)16-17)32-23-21(4-3-11-25-23)24(29)27-14-12-26(13-15-27)19-6-8-20(9-7-19)28(30)31/h3-11,16H,12-15H2,1-2H3 |
| InChIKey | VAFMMTYGIQDGKW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|