C29H28N4O3 — CID 17373098
[2-(2,5-dimethylphenyl)-8-methylquinolin-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 17373098) has the molecular formula C29H28N4O3 and a molecular weight of 480.57 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)-8-methylquinolin-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | [2-(2,5-dimethylphenyl)-8-methylquinolin-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 17373098 |
| Molecular Formula | C29H28N4O3 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | [2-(2,5-dimethylphenyl)-8-methylquinolin-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | Cc1ccc(C)c(-c2cc(C(=O)N3CCN(c4ccc([N+](=O)[O-])cc4)CC3)c3cccc(C)c3n2)c1 |
| InChI | InChI=1S/C29H28N4O3/c1-19-7-8-20(2)25(17-19)27-18-26(24-6-4-5-21(3)28(24)30-27)29(34)32-15-13-31(14-16-32)22-9-11-23(12-10-22)33(35)36/h4-12,17-18H,13-16H2,1-3H3 |
| InChIKey | BMVGSAQRZNCTNN-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|