C17H19N3O3S — CID 9273216
(2,5-dimethylthiophen-3-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 9273216) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is (2,5-dimethylthiophen-3-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | (2,5-dimethylthiophen-3-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 9273216 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | (2,5-dimethylthiophen-3-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | Cc1cc(C(=O)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)c(C)s1 |
| InChI | InChI=1S/C17H19N3O3S/c1-12-11-16(13(2)24-12)17(21)19-9-7-18(8-10-19)14-3-5-15(6-4-14)20(22)23/h3-6,11H,7-10H2,1-2H3 |
| InChIKey | RHBLJVHAYHAOCK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|