C11H13N3O2 — CID 3434794
N-[(4-amino-4-oxobutan-2-ylidene)amino]benzamide (PubChem CID 3434794) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is N-[(4-amino-4-oxobutan-2-ylidene)amino]benzamide.
| Compound Name | N-[(4-amino-4-oxobutan-2-ylidene)amino]benzamide |
|---|---|
| PubChem CID | 3434794 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | N-[(4-amino-4-oxobutan-2-ylidene)amino]benzamide |
| SMILES | CC(CC(N)=O)=NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C11H13N3O2/c1-8(7-10(12)15)13-14-11(16)9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H2,12,15)(H,14,16) |
| InChIKey | QCSUIGMQVKBKMD-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|