C18H16F3N3O2 — CID 5369499
N-[(Z)-[4-oxo-4-[2-(trifluoromethyl)anilino]butan-2-ylidene]amino]benzamide (PubChem CID 5369499) has the molecular formula C18H16F3N3O2 and a molecular weight of 363.34 g/mol. Its IUPAC name is N-[(Z)-[4-oxo-4-[2-(trifluoromethyl)anilino]butan-2-ylidene]amino]benzamide.
| Compound Name | N-[(Z)-[4-oxo-4-[2-(trifluoromethyl)anilino]butan-2-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 5369499 |
| Molecular Formula | C18H16F3N3O2 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | N-[(Z)-[4-oxo-4-[2-(trifluoromethyl)anilino]butan-2-ylidene]amino]benzamide |
| SMILES | C/C(CC(=O)Nc1ccccc1C(F)(F)F)=N/NC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H16F3N3O2/c1-12(23-24-17(26)13-7-3-2-4-8-13)11-16(25)22-15-10-6-5-9-14(15)18(19,20)21/h2-10H,11H2,1H3,(H,22,25)(H,24,26)/b23-12- |
| InChIKey | CNVPSGBXKXNXPF-FMCGGJTJSA-N |
| XLogP | 3.84 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|