C18H25N3O3S — CID 3434871
1-[2-acetamido-3-(4-methylphenyl)sulfanylpropanoyl]piperidine-3-carboxamide (PubChem CID 3434871) has the molecular formula C18H25N3O3S and a molecular weight of 363.48 g/mol. Its IUPAC name is 1-[2-acetamido-3-(4-methylphenyl)sulfanylpropanoyl]piperidine-3-carboxamide.
| Compound Name | 1-[2-acetamido-3-(4-methylphenyl)sulfanylpropanoyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 3434871 |
| Molecular Formula | C18H25N3O3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 1-[2-acetamido-3-(4-methylphenyl)sulfanylpropanoyl]piperidine-3-carboxamide |
| SMILES | CC(=O)NC(CSc1ccc(C)cc1)C(=O)N1CCCC(C(N)=O)C1 |
| InChI | InChI=1S/C18H25N3O3S/c1-12-5-7-15(8-6-12)25-11-16(20-13(2)22)18(24)21-9-3-4-14(10-21)17(19)23/h5-8,14,16H,3-4,9-11H2,1-2H3,(H2,19,23)(H,20,22) |
| InChIKey | WMYPKJKXXUOAIY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |