C19H25ClN2O4S — CID 4213260
ethyl 1-[2-acetamido-3-(4-chlorophenyl)sulfanylpropanoyl]piperidine-3-carboxylate (PubChem CID 4213260) has the molecular formula C19H25ClN2O4S and a molecular weight of 412.94 g/mol. Its IUPAC name is ethyl 1-[2-acetamido-3-(4-chlorophenyl)sulfanylpropanoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-acetamido-3-(4-chlorophenyl)sulfanylpropanoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 4213260 |
| Molecular Formula | C19H25ClN2O4S |
| Molecular Weight | 412.94 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | ethyl 1-[2-acetamido-3-(4-chlorophenyl)sulfanylpropanoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)C(CSc2ccc(Cl)cc2)NC(C)=O)C1 |
| InChI | InChI=1S/C19H25ClN2O4S/c1-3-26-19(25)14-5-4-10-22(11-14)18(24)17(21-13(2)23)12-27-16-8-6-15(20)7-9-16/h6-9,14,17H,3-5,10-12H2,1-2H3,(H,21,23) |
| InChIKey | LZEUGWNAFYOWGI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.94 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |