C10H9ClN2OS — CID 34363640
5-[(4-chlorophenyl)sulfanylmethyl]-1,2-dihydropyrazol-3-one (PubChem CID 34363640) has the molecular formula C10H9ClN2OS and a molecular weight of 240.72 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)sulfanylmethyl]-1,2-dihydropyrazol-3-one.
| Compound Name | 5-[(4-chlorophenyl)sulfanylmethyl]-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 34363640 |
| Molecular Formula | C10H9ClN2OS |
| Molecular Weight | 240.72 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | 5-[(4-chlorophenyl)sulfanylmethyl]-1,2-dihydropyrazol-3-one |
| SMILES | O=c1cc(CSc2ccc(Cl)cc2)[nH][nH]1 |
| InChI | InChI=1S/C10H9ClN2OS/c11-7-1-3-9(4-2-7)15-6-8-5-10(14)13-12-8/h1-5H,6H2,(H2,12,13,14) |
| InChIKey | KNBMOSHSMIPGFM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.72 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |