C11H9F2NO3S — CID 34365725
(1R,2S)-4-(2,4-difluorophenyl)-2-methyl-1-oxo-1,4-thiazinane-3,5-dione (PubChem CID 34365725) has the molecular formula C11H9F2NO3S and a molecular weight of 273.26 g/mol. Its IUPAC name is (1R,2S)-4-(2,4-difluorophenyl)-2-methyl-1-oxo-1,4-thiazinane-3,5-dione.
| Compound Name | (1R,2S)-4-(2,4-difluorophenyl)-2-methyl-1-oxo-1,4-thiazinane-3,5-dione |
|---|---|
| PubChem CID | 34365725 |
| Molecular Formula | C11H9F2NO3S |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | (1R,2S)-4-(2,4-difluorophenyl)-2-methyl-1-oxo-1,4-thiazinane-3,5-dione |
| SMILES | C[C@H]1C(=O)N(c2ccc(F)cc2F)C(=O)C[S@]1=O |
| InChI | InChI=1S/C11H9F2NO3S/c1-6-11(16)14(10(15)5-18(6)17)9-3-2-7(12)4-8(9)13/h2-4,6H,5H2,1H3/t6-,18+/m0/s1 |
| InChIKey | XLTKIDBARGZKRH-AHGSNSTDSA-N |
| XLogP | 0.98 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|