C12H11Cl2NO3S — CID 40558205
(1S,2S)-4-[(2,4-dichlorophenyl)methyl]-2-methyl-1-oxo-1,4-thiazinane-3,5-dione (PubChem CID 40558205) has the molecular formula C12H11Cl2NO3S and a molecular weight of 320.20 g/mol. Its IUPAC name is (1S,2S)-4-[(2,4-dichlorophenyl)methyl]-2-methyl-1-oxo-1,4-thiazinane-3,5-dione.
| Compound Name | (1S,2S)-4-[(2,4-dichlorophenyl)methyl]-2-methyl-1-oxo-1,4-thiazinane-3,5-dione |
|---|---|
| PubChem CID | 40558205 |
| Molecular Formula | C12H11Cl2NO3S |
| Molecular Weight | 320.20 g/mol |
| Exact Mass | 318.98 |
| IUPAC Name | (1S,2S)-4-[(2,4-dichlorophenyl)methyl]-2-methyl-1-oxo-1,4-thiazinane-3,5-dione |
| SMILES | C[C@H]1C(=O)N(Cc2ccc(Cl)cc2Cl)C(=O)C[S@@]1=O |
| InChI | InChI=1S/C12H11Cl2NO3S/c1-7-12(17)15(11(16)6-19(7)18)5-8-2-3-9(13)4-10(8)14/h2-4,7H,5-6H2,1H3/t7-,19-/m0/s1 |
| InChIKey | ONFXWNHSHPQFDF-IIYDVTGLSA-N |
| XLogP | 2.00 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.20 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|