C17H15Cl2NO2 — CID 126387003
(1R,2S,6S,7R)-4-[(2,4-dichlorophenyl)methyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 126387003) has the molecular formula C17H15Cl2NO2 and a molecular weight of 336.22 g/mol. Its IUPAC name is (1R,2S,6S,7R)-4-[(2,4-dichlorophenyl)methyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | (1R,2S,6S,7R)-4-[(2,4-dichlorophenyl)methyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 126387003 |
| Molecular Formula | C17H15Cl2NO2 |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | (1R,2S,6S,7R)-4-[(2,4-dichlorophenyl)methyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@@H](C(=O)N1Cc1ccc(Cl)cc1Cl)[C@H]1C=C[C@H]2CC1 |
| InChI | InChI=1S/C17H15Cl2NO2/c18-12-6-5-11(13(19)7-12)8-20-16(21)14-9-1-2-10(4-3-9)15(14)17(20)22/h1-2,5-7,9-10,14-15H,3-4,8H2/t9-,10-,14-,15-/m0/s1 |
| InChIKey | MHIFLIQIDYWAHU-CHPZLBCBSA-N |
| XLogP | 3.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|