C19H15Cl2N3O2 — CID 51852756
(1S,2R,6S,7R)-4-[1-[(2,4-dichlorophenyl)methyl]pyrazol-4-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 51852756) has the molecular formula C19H15Cl2N3O2 and a molecular weight of 388.25 g/mol. Its IUPAC name is (1S,2R,6S,7R)-4-[1-[(2,4-dichlorophenyl)methyl]pyrazol-4-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1S,2R,6S,7R)-4-[1-[(2,4-dichlorophenyl)methyl]pyrazol-4-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 51852756 |
| Molecular Formula | C19H15Cl2N3O2 |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | (1S,2R,6S,7R)-4-[1-[(2,4-dichlorophenyl)methyl]pyrazol-4-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1c1cnn(Cc3ccc(Cl)cc3Cl)c1)[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C19H15Cl2N3O2/c20-13-4-3-12(15(21)6-13)8-23-9-14(7-22-23)24-18(25)16-10-1-2-11(5-10)17(16)19(24)26/h1-4,6-7,9-11,16-17H,5,8H2/t10-,11+,16-,17+ |
| InChIKey | CIGHPEZOBMIUNR-QFBVAWSSSA-N |
| XLogP | 3.55 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|