C23H18Cl2N2O3 — CID 66491031
N-(2,4-dichlorophenyl)-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]acetamide (PubChem CID 66491031) has the molecular formula C23H18Cl2N2O3 and a molecular weight of 441.31 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]acetamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 66491031 |
| Molecular Formula | C23H18Cl2N2O3 |
| Molecular Weight | 441.31 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]acetamide |
| SMILES | O=C(Cc1ccc(N2C(=O)C3C4C=CC(C4)C3C2=O)cc1)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H18Cl2N2O3/c24-15-5-8-18(17(25)11-15)26-19(28)9-12-1-6-16(7-2-12)27-22(29)20-13-3-4-14(10-13)21(20)23(27)30/h1-8,11,13-14,20-21H,9-10H2,(H,26,28) |
| InChIKey | GHKNQOLMJNJKIQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.31 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|