C18H15Cl2NO2 — CID 2967024
4-[(2,4-dichlorophenyl)methyl]spiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione (PubChem CID 2967024) has the molecular formula C18H15Cl2NO2 and a molecular weight of 348.23 g/mol. Its IUPAC name is 4-[(2,4-dichlorophenyl)methyl]spiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione.
| Compound Name | 4-[(2,4-dichlorophenyl)methyl]spiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione |
|---|---|
| PubChem CID | 2967024 |
| Molecular Formula | C18H15Cl2NO2 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 4-[(2,4-dichlorophenyl)methyl]spiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione |
| SMILES | O=C1C2C(C(=O)N1Cc1ccc(Cl)cc1Cl)C1C=CC2C12CC2 |
| InChI | InChI=1S/C18H15Cl2NO2/c19-10-2-1-9(13(20)7-10)8-21-16(22)14-11-3-4-12(15(14)17(21)23)18(11)5-6-18/h1-4,7,11-12,14-15H,5-6,8H2 |
| InChIKey | QMQPDCDNMPUVBK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|