C13H14Cl2N2O2S — CID 21498457
3-[(2,4-dichlorophenyl)methyl]-5-(1-methylsulfanylethyl)imidazolidine-2,4-dione (PubChem CID 21498457) has the molecular formula C13H14Cl2N2O2S and a molecular weight of 333.24 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenyl)methyl]-5-(1-methylsulfanylethyl)imidazolidine-2,4-dione.
| Compound Name | 3-[(2,4-dichlorophenyl)methyl]-5-(1-methylsulfanylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 21498457 |
| Molecular Formula | C13H14Cl2N2O2S |
| Molecular Weight | 333.24 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 3-[(2,4-dichlorophenyl)methyl]-5-(1-methylsulfanylethyl)imidazolidine-2,4-dione |
| SMILES | CSC(C)C1NC(=O)N(Cc2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C13H14Cl2N2O2S/c1-7(20-2)11-12(18)17(13(19)16-11)6-8-3-4-9(14)5-10(8)15/h3-5,7,11H,6H2,1-2H3,(H,16,19) |
| InChIKey | XRSJMUAOZGCXFH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.24 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|