C31H33N5O4 — CID 3436686
2-amino-1-(3-butoxyphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]pyrrolo[3,2-b]quinoxaline-3-carboxamide (PubChem CID 3436686) has the molecular formula C31H33N5O4 and a molecular weight of 539.64 g/mol. Its IUPAC name is 2-amino-1-(3-butoxyphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]pyrrolo[3,2-b]quinoxaline-3-carboxamide.
| Compound Name | 2-amino-1-(3-butoxyphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]pyrrolo[3,2-b]quinoxaline-3-carboxamide |
|---|---|
| PubChem CID | 3436686 |
| Molecular Formula | C31H33N5O4 |
| Molecular Weight | 539.64 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | 2-amino-1-(3-butoxyphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]pyrrolo[3,2-b]quinoxaline-3-carboxamide |
| SMILES | CCCCOc1cccc(-n2c(N)c(C(=O)NCCc3ccc(OC)c(OC)c3)c3nc4ccccc4nc32)c1 |
| InChI | InChI=1S/C31H33N5O4/c1-4-5-17-40-22-10-8-9-21(19-22)36-29(32)27(28-30(36)35-24-12-7-6-11-23(24)34-28)31(37)33-16-15-20-13-14-25(38-2)26(18-20)39-3/h6-14,18-19H,4-5,15-17,32H2,1-3H3,(H,33,37) |
| InChIKey | LBZJDRKWVFPBGF-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.64 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|