C27H21ClFN4O3+ — CID 3437970
3-[2-(4-chlorophenyl)-3-oxo-5-propan-2-yl-1H-pyrazol-4-yl]-1-(2-fluorophenyl)-4-pyridin-1-ium-1-ylpyrrole-2,5-dione (PubChem CID 3437970) has the molecular formula C27H21ClFN4O3+ and a molecular weight of 503.94 g/mol. Its IUPAC name is 3-[2-(4-chlorophenyl)-3-oxo-5-propan-2-yl-1H-pyrazol-4-yl]-1-(2-fluorophenyl)-4-pyridin-1-ium-1-ylpyrrole-2,5-dione.
| Compound Name | 3-[2-(4-chlorophenyl)-3-oxo-5-propan-2-yl-1H-pyrazol-4-yl]-1-(2-fluorophenyl)-4-pyridin-1-ium-1-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 3437970 |
| Molecular Formula | C27H21ClFN4O3+ |
| Molecular Weight | 503.94 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | 3-[2-(4-chlorophenyl)-3-oxo-5-propan-2-yl-1H-pyrazol-4-yl]-1-(2-fluorophenyl)-4-pyridin-1-ium-1-ylpyrrole-2,5-dione |
| SMILES | CC(C)c1[nH]n(-c2ccc(Cl)cc2)c(=O)c1C1=C([n+]2ccccc2)C(=O)N(c2ccccc2F)C1=O |
| InChI | InChI=1S/C27H20ClFN4O3/c1-16(2)23-21(26(35)33(30-23)18-12-10-17(28)11-13-18)22-24(31-14-6-3-7-15-31)27(36)32(25(22)34)20-9-5-4-8-19(20)29/h3-16H,1-2H3/p+1 |
| InChIKey | ZWSLSSRGVSDGNN-UHFFFAOYSA-O |
| XLogP | 4.31 |
| TPSA | 79.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.94 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|