C28H21Cl2FN4O3 — CID 3982618
1-(3,4-dichlorophenyl)-4-[1-(2-fluorophenyl)-4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxopyrrol-3-yl]-3-propan-2-ylpyrazol-5-olate (PubChem CID 3982618) has the molecular formula C28H21Cl2FN4O3 and a molecular weight of 551.41 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-4-[1-(2-fluorophenyl)-4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxopyrrol-3-yl]-3-propan-2-ylpyrazol-5-olate.
| Compound Name | 1-(3,4-dichlorophenyl)-4-[1-(2-fluorophenyl)-4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxopyrrol-3-yl]-3-propan-2-ylpyrazol-5-olate |
|---|---|
| PubChem CID | 3982618 |
| Molecular Formula | C28H21Cl2FN4O3 |
| Molecular Weight | 551.41 g/mol |
| Exact Mass | 550.10 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-4-[1-(2-fluorophenyl)-4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxopyrrol-3-yl]-3-propan-2-ylpyrazol-5-olate |
| SMILES | Cc1ccc[n+](C2=C(c3c(C(C)C)nn(-c4ccc(Cl)c(Cl)c4)c3[O-])C(=O)N(c3ccccc3F)C2=O)c1 |
| InChI | InChI=1S/C28H21Cl2FN4O3/c1-15(2)24-22(27(37)35(32-24)17-10-11-18(29)19(30)13-17)23-25(33-12-6-7-16(3)14-33)28(38)34(26(23)36)21-9-5-4-8-20(21)31/h4-15H,1-3H3 |
| InChIKey | BDJRUUDJTBEFER-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.41 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|