C26H27ClN4O3 — CID 3920725
1-(3-chlorophenyl)-4-[4-(3,4-dimethylpyridin-1-ium-1-yl)-2,5-dioxo-1-propylpyrrol-3-yl]-3-propan-2-ylpyrazol-5-olate (PubChem CID 3920725) has the molecular formula C26H27ClN4O3 and a molecular weight of 478.98 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-[4-(3,4-dimethylpyridin-1-ium-1-yl)-2,5-dioxo-1-propylpyrrol-3-yl]-3-propan-2-ylpyrazol-5-olate.
| Compound Name | 1-(3-chlorophenyl)-4-[4-(3,4-dimethylpyridin-1-ium-1-yl)-2,5-dioxo-1-propylpyrrol-3-yl]-3-propan-2-ylpyrazol-5-olate |
|---|---|
| PubChem CID | 3920725 |
| Molecular Formula | C26H27ClN4O3 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 1-(3-chlorophenyl)-4-[4-(3,4-dimethylpyridin-1-ium-1-yl)-2,5-dioxo-1-propylpyrrol-3-yl]-3-propan-2-ylpyrazol-5-olate |
| SMILES | CCCN1C(=O)C(c2c(C(C)C)nn(-c3cccc(Cl)c3)c2[O-])=C([n+]2ccc(C)c(C)c2)C1=O |
| InChI | InChI=1S/C26H27ClN4O3/c1-6-11-30-24(32)21(23(26(30)34)29-12-10-16(4)17(5)14-29)20-22(15(2)3)28-31(25(20)33)19-9-7-8-18(27)13-19/h7-10,12-15H,6,11H2,1-5H3 |
| InChIKey | MKFYKXSOKRKOGR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|