C25H24Cl2N4O3 — CID 4012365
1-(3,4-dichlorophenyl)-4-[4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxo-1-propylpyrrol-3-yl]-3-propan-2-ylpyrazol-5-olate (PubChem CID 4012365) has the molecular formula C25H24Cl2N4O3 and a molecular weight of 499.40 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-4-[4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxo-1-propylpyrrol-3-yl]-3-propan-2-ylpyrazol-5-olate.
| Compound Name | 1-(3,4-dichlorophenyl)-4-[4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxo-1-propylpyrrol-3-yl]-3-propan-2-ylpyrazol-5-olate |
|---|---|
| PubChem CID | 4012365 |
| Molecular Formula | C25H24Cl2N4O3 |
| Molecular Weight | 499.40 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-4-[4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxo-1-propylpyrrol-3-yl]-3-propan-2-ylpyrazol-5-olate |
| SMILES | CCCN1C(=O)C(c2c(C(C)C)nn(-c3ccc(Cl)c(Cl)c3)c2[O-])=C([n+]2cccc(C)c2)C1=O |
| InChI | InChI=1S/C25H24Cl2N4O3/c1-5-10-30-23(32)20(22(25(30)34)29-11-6-7-15(4)13-29)19-21(14(2)3)28-31(24(19)33)16-8-9-17(26)18(27)12-16/h6-9,11-14H,5,10H2,1-4H3 |
| InChIKey | XDGLZLBPOIPZPV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|