C27H26Cl2N4O4 — CID 4528242
1-(3,4-dichlorophenyl)-4-[4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxo-1-(oxolan-2-ylmethyl)pyrrol-3-yl]-3-propylpyrazol-5-olate (PubChem CID 4528242) has the molecular formula C27H26Cl2N4O4 and a molecular weight of 541.44 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-4-[4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxo-1-(oxolan-2-ylmethyl)pyrrol-3-yl]-3-propylpyrazol-5-olate.
| Compound Name | 1-(3,4-dichlorophenyl)-4-[4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxo-1-(oxolan-2-ylmethyl)pyrrol-3-yl]-3-propylpyrazol-5-olate |
|---|---|
| PubChem CID | 4528242 |
| Molecular Formula | C27H26Cl2N4O4 |
| Molecular Weight | 541.44 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-4-[4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxo-1-(oxolan-2-ylmethyl)pyrrol-3-yl]-3-propylpyrazol-5-olate |
| SMILES | CCCc1nn(-c2ccc(Cl)c(Cl)c2)c([O-])c1C1=C([n+]2cccc(C)c2)C(=O)N(CC2CCCO2)C1=O |
| InChI | InChI=1S/C27H26Cl2N4O4/c1-3-6-21-22(26(35)33(30-21)17-9-10-19(28)20(29)13-17)23-24(31-11-4-7-16(2)14-31)27(36)32(25(23)34)15-18-8-5-12-37-18/h4,7,9-11,13-14,18H,3,5-6,8,12,15H2,1-2H3 |
| InChIKey | PNFRETHSELZGMP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|