C27H27Cl2N4O4+ — CID 98425084
3-[2-(3,4-dichlorophenyl)-3-oxo-5-propyl-1H-pyrazol-4-yl]-4-(3-methylpyridin-1-ium-1-yl)-1-[[(2S)-oxolan-2-yl]methyl]pyrrole-2,5-dione (PubChem CID 98425084) has the molecular formula C27H27Cl2N4O4+ and a molecular weight of 542.44 g/mol. Its IUPAC name is 3-[2-(3,4-dichlorophenyl)-3-oxo-5-propyl-1H-pyrazol-4-yl]-4-(3-methylpyridin-1-ium-1-yl)-1-[[(2S)-oxolan-2-yl]methyl]pyrrole-2,5-dione.
| Compound Name | 3-[2-(3,4-dichlorophenyl)-3-oxo-5-propyl-1H-pyrazol-4-yl]-4-(3-methylpyridin-1-ium-1-yl)-1-[[(2S)-oxolan-2-yl]methyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 98425084 |
| Molecular Formula | C27H27Cl2N4O4+ |
| Molecular Weight | 542.44 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | 3-[2-(3,4-dichlorophenyl)-3-oxo-5-propyl-1H-pyrazol-4-yl]-4-(3-methylpyridin-1-ium-1-yl)-1-[[(2S)-oxolan-2-yl]methyl]pyrrole-2,5-dione |
| SMILES | CCCc1[nH]n(-c2ccc(Cl)c(Cl)c2)c(=O)c1C1=C([n+]2cccc(C)c2)C(=O)N(C[C@@H]2CCCO2)C1=O |
| InChI | InChI=1S/C27H26Cl2N4O4/c1-3-6-21-22(26(35)33(30-21)17-9-10-19(28)20(29)13-17)23-24(31-11-4-7-16(2)14-31)27(36)32(25(23)34)15-18-8-5-12-37-18/h4,7,9-11,13-14,18H,3,5-6,8,12,15H2,1-2H3/p+1/t18-/m0/s1 |
| InChIKey | PNFRETHSELZGMP-SFHVURJKSA-O |
| XLogP | 3.94 |
| TPSA | 88.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|