C29H24Cl2FN4O3+ — CID 4024130
3-[2-(3,4-dichlorophenyl)-3-oxo-5-propyl-1H-pyrazol-4-yl]-1-[(4-fluorophenyl)methyl]-4-(3-methylpyridin-1-ium-1-yl)pyrrole-2,5-dione (PubChem CID 4024130) has the molecular formula C29H24Cl2FN4O3+ and a molecular weight of 566.44 g/mol. Its IUPAC name is 3-[2-(3,4-dichlorophenyl)-3-oxo-5-propyl-1H-pyrazol-4-yl]-1-[(4-fluorophenyl)methyl]-4-(3-methylpyridin-1-ium-1-yl)pyrrole-2,5-dione.
| Compound Name | 3-[2-(3,4-dichlorophenyl)-3-oxo-5-propyl-1H-pyrazol-4-yl]-1-[(4-fluorophenyl)methyl]-4-(3-methylpyridin-1-ium-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 4024130 |
| Molecular Formula | C29H24Cl2FN4O3+ |
| Molecular Weight | 566.44 g/mol |
| Exact Mass | 565.12 |
| IUPAC Name | 3-[2-(3,4-dichlorophenyl)-3-oxo-5-propyl-1H-pyrazol-4-yl]-1-[(4-fluorophenyl)methyl]-4-(3-methylpyridin-1-ium-1-yl)pyrrole-2,5-dione |
| SMILES | CCCc1[nH]n(-c2ccc(Cl)c(Cl)c2)c(=O)c1C1=C([n+]2cccc(C)c2)C(=O)N(Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C29H23Cl2FN4O3/c1-3-5-23-24(28(38)36(33-23)20-11-12-21(30)22(31)14-20)25-26(34-13-4-6-17(2)15-34)29(39)35(27(25)37)16-18-7-9-19(32)10-8-18/h4,6-15H,3,5,16H2,1-2H3/p+1 |
| InChIKey | ACWDCWVXNYKVQE-UHFFFAOYSA-O |
| XLogP | 5.10 |
| TPSA | 79.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.44 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|