C26H28ClN4O3+ — CID 4558585
3-[2-(3-chlorophenyl)-3-oxo-5-propyl-1H-pyrazol-4-yl]-4-(3-ethylpyridin-1-ium-1-yl)-1-propylpyrrole-2,5-dione (PubChem CID 4558585) has the molecular formula C26H28ClN4O3+ and a molecular weight of 479.99 g/mol. Its IUPAC name is 3-[2-(3-chlorophenyl)-3-oxo-5-propyl-1H-pyrazol-4-yl]-4-(3-ethylpyridin-1-ium-1-yl)-1-propylpyrrole-2,5-dione.
| Compound Name | 3-[2-(3-chlorophenyl)-3-oxo-5-propyl-1H-pyrazol-4-yl]-4-(3-ethylpyridin-1-ium-1-yl)-1-propylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 4558585 |
| Molecular Formula | C26H28ClN4O3+ |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 3-[2-(3-chlorophenyl)-3-oxo-5-propyl-1H-pyrazol-4-yl]-4-(3-ethylpyridin-1-ium-1-yl)-1-propylpyrrole-2,5-dione |
| SMILES | CCCc1[nH]n(-c2cccc(Cl)c2)c(=O)c1C1=C([n+]2cccc(CC)c2)C(=O)N(CCC)C1=O |
| InChI | InChI=1S/C26H27ClN4O3/c1-4-9-20-21(25(33)31(28-20)19-12-7-11-18(27)15-19)22-23(26(34)30(13-5-2)24(22)32)29-14-8-10-17(6-3)16-29/h7-8,10-12,14-16H,4-6,9,13H2,1-3H3/p+1 |
| InChIKey | UCVSPZBJIGVTAQ-UHFFFAOYSA-O |
| XLogP | 3.77 |
| TPSA | 79.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|