C25H27N4O3+ — CID 4310937
3-(3,5-dimethylpyridin-1-ium-1-yl)-4-(5-ethyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)-1-propylpyrrole-2,5-dione (PubChem CID 4310937) has the molecular formula C25H27N4O3+ and a molecular weight of 431.52 g/mol. Its IUPAC name is 3-(3,5-dimethylpyridin-1-ium-1-yl)-4-(5-ethyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)-1-propylpyrrole-2,5-dione.
| Compound Name | 3-(3,5-dimethylpyridin-1-ium-1-yl)-4-(5-ethyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)-1-propylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 4310937 |
| Molecular Formula | C25H27N4O3+ |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 3-(3,5-dimethylpyridin-1-ium-1-yl)-4-(5-ethyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)-1-propylpyrrole-2,5-dione |
| SMILES | CCCN1C(=O)C(c2c(CC)[nH]n(-c3ccccc3)c2=O)=C([n+]2cc(C)cc(C)c2)C1=O |
| InChI | InChI=1S/C25H26N4O3/c1-5-12-28-23(30)21(22(25(28)32)27-14-16(3)13-17(4)15-27)20-19(6-2)26-29(24(20)31)18-10-8-7-9-11-18/h7-11,13-15H,5-6,12H2,1-4H3/p+1 |
| InChIKey | QYHJOQAEYFXKIS-UHFFFAOYSA-O |
| XLogP | 2.78 |
| TPSA | 79.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|