C24H23ClN4O3 — CID 3905279
1-(3-chlorophenyl)-4-(2,5-dioxo-1-propyl-4-pyridin-1-ium-1-ylpyrrol-3-yl)-3-propylpyrazol-5-olate (PubChem CID 3905279) has the molecular formula C24H23ClN4O3 and a molecular weight of 450.93 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-(2,5-dioxo-1-propyl-4-pyridin-1-ium-1-ylpyrrol-3-yl)-3-propylpyrazol-5-olate.
| Compound Name | 1-(3-chlorophenyl)-4-(2,5-dioxo-1-propyl-4-pyridin-1-ium-1-ylpyrrol-3-yl)-3-propylpyrazol-5-olate |
|---|---|
| PubChem CID | 3905279 |
| Molecular Formula | C24H23ClN4O3 |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 1-(3-chlorophenyl)-4-(2,5-dioxo-1-propyl-4-pyridin-1-ium-1-ylpyrrol-3-yl)-3-propylpyrazol-5-olate |
| SMILES | CCCc1nn(-c2cccc(Cl)c2)c([O-])c1C1=C([n+]2ccccc2)C(=O)N(CCC)C1=O |
| InChI | InChI=1S/C24H23ClN4O3/c1-3-9-18-19(23(31)29(26-18)17-11-8-10-16(25)15-17)20-21(27-13-6-5-7-14-27)24(32)28(12-4-2)22(20)30/h5-8,10-11,13-15H,3-4,9,12H2,1-2H3 |
| InChIKey | DTKGCLWOQJUTNA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|