C27H27ClN4O3 — CID 3880250
1-(3-chlorophenyl)-4-[1-cyclohexyl-4-(4-methylpyridin-1-ium-1-yl)-2,5-dioxopyrrol-3-yl]-3-ethylpyrazol-5-olate (PubChem CID 3880250) has the molecular formula C27H27ClN4O3 and a molecular weight of 490.99 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-[1-cyclohexyl-4-(4-methylpyridin-1-ium-1-yl)-2,5-dioxopyrrol-3-yl]-3-ethylpyrazol-5-olate.
| Compound Name | 1-(3-chlorophenyl)-4-[1-cyclohexyl-4-(4-methylpyridin-1-ium-1-yl)-2,5-dioxopyrrol-3-yl]-3-ethylpyrazol-5-olate |
|---|---|
| PubChem CID | 3880250 |
| Molecular Formula | C27H27ClN4O3 |
| Molecular Weight | 490.99 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 1-(3-chlorophenyl)-4-[1-cyclohexyl-4-(4-methylpyridin-1-ium-1-yl)-2,5-dioxopyrrol-3-yl]-3-ethylpyrazol-5-olate |
| SMILES | CCc1nn(-c2cccc(Cl)c2)c([O-])c1C1=C([n+]2ccc(C)cc2)C(=O)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C27H27ClN4O3/c1-3-21-22(26(34)32(29-21)20-11-7-8-18(28)16-20)23-24(30-14-12-17(2)13-15-30)27(35)31(25(23)33)19-9-5-4-6-10-19/h7-8,11-16,19H,3-6,9-10H2,1-2H3 |
| InChIKey | WARNOXSLPJOEGH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.99 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|