C28H29ClN4O3 — CID 4565968
1-(3-chlorophenyl)-4-[1-cyclohexyl-4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxopyrrol-3-yl]-3-propylpyrazol-5-olate (PubChem CID 4565968) has the molecular formula C28H29ClN4O3 and a molecular weight of 505.02 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-[1-cyclohexyl-4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxopyrrol-3-yl]-3-propylpyrazol-5-olate.
| Compound Name | 1-(3-chlorophenyl)-4-[1-cyclohexyl-4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxopyrrol-3-yl]-3-propylpyrazol-5-olate |
|---|---|
| PubChem CID | 4565968 |
| Molecular Formula | C28H29ClN4O3 |
| Molecular Weight | 505.02 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | 1-(3-chlorophenyl)-4-[1-cyclohexyl-4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxopyrrol-3-yl]-3-propylpyrazol-5-olate |
| SMILES | CCCc1nn(-c2cccc(Cl)c2)c([O-])c1C1=C([n+]2cccc(C)c2)C(=O)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C28H29ClN4O3/c1-3-9-22-23(27(35)33(30-22)21-14-7-11-19(29)16-21)24-25(31-15-8-10-18(2)17-31)28(36)32(26(24)34)20-12-5-4-6-13-20/h7-8,10-11,14-17,20H,3-6,9,12-13H2,1-2H3 |
| InChIKey | CUDUZCVBFDDCRQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.02 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|