C28H23ClN4O4 — CID 4018121
1-(3-chlorophenyl)-3-ethyl-4-[1-(4-methoxyphenyl)-4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxopyrrol-3-yl]pyrazol-5-olate (PubChem CID 4018121) has the molecular formula C28H23ClN4O4 and a molecular weight of 514.97 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-ethyl-4-[1-(4-methoxyphenyl)-4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxopyrrol-3-yl]pyrazol-5-olate.
| Compound Name | 1-(3-chlorophenyl)-3-ethyl-4-[1-(4-methoxyphenyl)-4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxopyrrol-3-yl]pyrazol-5-olate |
|---|---|
| PubChem CID | 4018121 |
| Molecular Formula | C28H23ClN4O4 |
| Molecular Weight | 514.97 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 1-(3-chlorophenyl)-3-ethyl-4-[1-(4-methoxyphenyl)-4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxopyrrol-3-yl]pyrazol-5-olate |
| SMILES | CCc1nn(-c2cccc(Cl)c2)c([O-])c1C1=C([n+]2cccc(C)c2)C(=O)N(c2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C28H23ClN4O4/c1-4-22-23(27(35)33(30-22)20-9-5-8-18(29)15-20)24-25(31-14-6-7-17(2)16-31)28(36)32(26(24)34)19-10-12-21(37-3)13-11-19/h5-16H,4H2,1-3H3 |
| InChIKey | VVLGERLMKFKDFZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.97 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|