C28H24N4O3 — CID 3952144
4-[1-benzyl-4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxopyrrol-3-yl]-3-ethyl-1-phenylpyrazol-5-olate (PubChem CID 3952144) has the molecular formula C28H24N4O3 and a molecular weight of 464.53 g/mol. Its IUPAC name is 4-[1-benzyl-4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxopyrrol-3-yl]-3-ethyl-1-phenylpyrazol-5-olate.
| Compound Name | 4-[1-benzyl-4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxopyrrol-3-yl]-3-ethyl-1-phenylpyrazol-5-olate |
|---|---|
| PubChem CID | 3952144 |
| Molecular Formula | C28H24N4O3 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 4-[1-benzyl-4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxopyrrol-3-yl]-3-ethyl-1-phenylpyrazol-5-olate |
| SMILES | CCc1nn(-c2ccccc2)c([O-])c1C1=C([n+]2cccc(C)c2)C(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C28H24N4O3/c1-3-22-23(27(34)32(29-22)21-14-8-5-9-15-21)24-25(30-16-10-11-19(2)17-30)28(35)31(26(24)33)18-20-12-6-4-7-13-20/h4-17H,3,18H2,1-2H3 |
| InChIKey | BDZDOZLEXNCTIK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|