C26H19FN4O3 — CID 4005126
4-(1-benzyl-2,5-dioxo-4-pyridin-1-ium-1-ylpyrrol-3-yl)-1-(4-fluorophenyl)-3-methylpyrazol-5-olate (PubChem CID 4005126) has the molecular formula C26H19FN4O3 and a molecular weight of 454.46 g/mol. Its IUPAC name is 4-(1-benzyl-2,5-dioxo-4-pyridin-1-ium-1-ylpyrrol-3-yl)-1-(4-fluorophenyl)-3-methylpyrazol-5-olate.
| Compound Name | 4-(1-benzyl-2,5-dioxo-4-pyridin-1-ium-1-ylpyrrol-3-yl)-1-(4-fluorophenyl)-3-methylpyrazol-5-olate |
|---|---|
| PubChem CID | 4005126 |
| Molecular Formula | C26H19FN4O3 |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 4-(1-benzyl-2,5-dioxo-4-pyridin-1-ium-1-ylpyrrol-3-yl)-1-(4-fluorophenyl)-3-methylpyrazol-5-olate |
| SMILES | Cc1nn(-c2ccc(F)cc2)c([O-])c1C1=C([n+]2ccccc2)C(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C26H19FN4O3/c1-17-21(25(33)31(28-17)20-12-10-19(27)11-13-20)22-23(29-14-6-3-7-15-29)26(34)30(24(22)32)16-18-8-4-2-5-9-18/h2-15H,16H2,1H3 |
| InChIKey | HFWCYIGIZHOQFQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|