C22H19FN4O3 — CID 4007893
4-(2,5-dioxo-1-propan-2-yl-4-pyridin-1-ium-1-ylpyrrol-3-yl)-1-(4-fluorophenyl)-3-methylpyrazol-5-olate (PubChem CID 4007893) has the molecular formula C22H19FN4O3 and a molecular weight of 406.42 g/mol. Its IUPAC name is 4-(2,5-dioxo-1-propan-2-yl-4-pyridin-1-ium-1-ylpyrrol-3-yl)-1-(4-fluorophenyl)-3-methylpyrazol-5-olate.
| Compound Name | 4-(2,5-dioxo-1-propan-2-yl-4-pyridin-1-ium-1-ylpyrrol-3-yl)-1-(4-fluorophenyl)-3-methylpyrazol-5-olate |
|---|---|
| PubChem CID | 4007893 |
| Molecular Formula | C22H19FN4O3 |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 4-(2,5-dioxo-1-propan-2-yl-4-pyridin-1-ium-1-ylpyrrol-3-yl)-1-(4-fluorophenyl)-3-methylpyrazol-5-olate |
| SMILES | Cc1nn(-c2ccc(F)cc2)c([O-])c1C1=C([n+]2ccccc2)C(=O)N(C(C)C)C1=O |
| InChI | InChI=1S/C22H19FN4O3/c1-13(2)26-20(28)18(19(22(26)30)25-11-5-4-6-12-25)17-14(3)24-27(21(17)29)16-9-7-15(23)8-10-16/h4-13H,1-3H3 |
| InChIKey | KWALLBNFRIOWLS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|