C29H25FN4O3 — CID 3472283
4-[4-(3,4-dimethylpyridin-1-ium-1-yl)-2,5-dioxo-1-phenylpyrrol-3-yl]-1-(4-fluorophenyl)-3-propylpyrazol-5-olate (PubChem CID 3472283) has the molecular formula C29H25FN4O3 and a molecular weight of 496.54 g/mol. Its IUPAC name is 4-[4-(3,4-dimethylpyridin-1-ium-1-yl)-2,5-dioxo-1-phenylpyrrol-3-yl]-1-(4-fluorophenyl)-3-propylpyrazol-5-olate.
| Compound Name | 4-[4-(3,4-dimethylpyridin-1-ium-1-yl)-2,5-dioxo-1-phenylpyrrol-3-yl]-1-(4-fluorophenyl)-3-propylpyrazol-5-olate |
|---|---|
| PubChem CID | 3472283 |
| Molecular Formula | C29H25FN4O3 |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 4-[4-(3,4-dimethylpyridin-1-ium-1-yl)-2,5-dioxo-1-phenylpyrrol-3-yl]-1-(4-fluorophenyl)-3-propylpyrazol-5-olate |
| SMILES | CCCc1nn(-c2ccc(F)cc2)c([O-])c1C1=C([n+]2ccc(C)c(C)c2)C(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C29H25FN4O3/c1-4-8-23-24(28(36)34(31-23)22-13-11-20(30)12-14-22)25-26(32-16-15-18(2)19(3)17-32)29(37)33(27(25)35)21-9-6-5-7-10-21/h5-7,9-17H,4,8H2,1-3H3 |
| InChIKey | CFLBCCZRZMGLIH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|