C28H22N4O5 — CID 3993829
4-[1-(1,3-benzodioxol-5-yl)-4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxopyrrol-3-yl]-3-ethyl-1-phenylpyrazol-5-olate (PubChem CID 3993829) has the molecular formula C28H22N4O5 and a molecular weight of 494.51 g/mol. Its IUPAC name is 4-[1-(1,3-benzodioxol-5-yl)-4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxopyrrol-3-yl]-3-ethyl-1-phenylpyrazol-5-olate.
| Compound Name | 4-[1-(1,3-benzodioxol-5-yl)-4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxopyrrol-3-yl]-3-ethyl-1-phenylpyrazol-5-olate |
|---|---|
| PubChem CID | 3993829 |
| Molecular Formula | C28H22N4O5 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 4-[1-(1,3-benzodioxol-5-yl)-4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxopyrrol-3-yl]-3-ethyl-1-phenylpyrazol-5-olate |
| SMILES | CCc1nn(-c2ccccc2)c([O-])c1C1=C([n+]2cccc(C)c2)C(=O)N(c2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C28H22N4O5/c1-3-20-23(27(34)32(29-20)18-9-5-4-6-10-18)24-25(30-13-7-8-17(2)15-30)28(35)31(26(24)33)19-11-12-21-22(14-19)37-16-36-21/h4-15H,3,16H2,1-2H3 |
| InChIKey | JQCMQHJTYFXWDJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|