C29H25ClN4O3 — CID 3948049
1-(3-chlorophenyl)-4-[1-(4-methylphenyl)-4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxopyrrol-3-yl]-3-propylpyrazol-5-olate (PubChem CID 3948049) has the molecular formula C29H25ClN4O3 and a molecular weight of 513.00 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-[1-(4-methylphenyl)-4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxopyrrol-3-yl]-3-propylpyrazol-5-olate.
| Compound Name | 1-(3-chlorophenyl)-4-[1-(4-methylphenyl)-4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxopyrrol-3-yl]-3-propylpyrazol-5-olate |
|---|---|
| PubChem CID | 3948049 |
| Molecular Formula | C29H25ClN4O3 |
| Molecular Weight | 513.00 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | 1-(3-chlorophenyl)-4-[1-(4-methylphenyl)-4-(3-methylpyridin-1-ium-1-yl)-2,5-dioxopyrrol-3-yl]-3-propylpyrazol-5-olate |
| SMILES | CCCc1nn(-c2cccc(Cl)c2)c([O-])c1C1=C([n+]2cccc(C)c2)C(=O)N(c2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C29H25ClN4O3/c1-4-7-23-24(28(36)34(31-23)22-10-5-9-20(30)16-22)25-26(32-15-6-8-19(3)17-32)29(37)33(27(25)35)21-13-11-18(2)12-14-21/h5-6,8-17H,4,7H2,1-3H3 |
| InChIKey | BTZPTJUXIZUEQW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.00 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|